Products
Our Products
| Product Name | Cas No. | Molecular Formula | ||||||||
| Iso Cyclosporin H | 83602-43-1 | C62H111N11O12 | ||||||||
| Calcitriol Impurity A(5,6-trans-Calcitriol) | 73837-24-8 | C27H44O3 | ||||||||
| Calcitriol Impurity B | 66791-71-7 | C27H44O3 | ||||||||
| Calcitriol Impurity C | N/A | C35H49N3O5 | ||||||||
| Cefixime Impurity A(EP) | 1614255-90-1 | C16H17N5O8S2 | ||||||||
| Cefixime Impurity B (Mixture of Diastereomers) (EP) | 1335475-19-8 | C15H17N5O6S2 | ||||||||
| Cefixime Impurity C (EP) (Cefixime 7-epimer ) | 108691-83-4 | C16H15N5O7S2 | ||||||||
| Cefixime Impurity D (EP) (Cefixime E-isomer ) | 97164-56-2 | C16H15N5O7S2 | ||||||||
| Cefixime Impurity E (EP) | 72701-01-0 | C15H15N5O7S2 | ||||||||
| Cefixime Impurity F (EP) | 79368-95-9 | C18H19N5O7S2 | ||||||||
| Cefixime Methyl Ester | 88621-01-6 | C17H17N5O7S2 | ||||||||
| Rifamycin Y | 15271-73-5 | C39H47NO15 | ||||||||
| Spiramycin I | N/A | C43H74N2O14 | ||||||||
| Spiramycin EP Impurity A | N/A | C36H62N2O11 | ||||||||
| Spiramycin EP Impurity B | 249930-66-3 | C43H76N2O14 | ||||||||
| Spiramycin EP Impurity C | 177584-13-3 | C44H74N2O14 | ||||||||
| Spiramycin EP Impurity D | 87708-39-2 | C42H71NO16 | ||||||||
| Spiramycin EP Impurity E | N/A | C43H76N2O13 | ||||||||
| Spiramycin EP Impurity F(Spiramycin Dimer) | N/A | C84H140N4O26 | ||||||||
| Spiramycin EP Impurity G(Neospiramycin II) | N/A | C38H64N2O12 | ||||||||
| Spiramycin EP Impurity H (Neospiramycin III) | N/A | C39H66N2O12 | ||||||||
| Spiramycin II (Acetylspiramycin) | 24916-51-6 | C45H76N2O15 | ||||||||
| Cefoxitin | 33564-30-6 | C16H16N3NaO7S2 | ||||||||
| Cefoxitin EP Impurity A(Decarbamoyl cefoxitin) | 54333-94-7 | C15H16N2O6S2 | ||||||||
| Cefoxitin EP Impurity B(Δ2-Cefoxitin) | 1422023-32-2 | C16H17N3O7S2 | ||||||||
| Cefoxitin EP Impurity C(Cephalothin Impurity D) | 10590-10-0 | C14H12N2O4S2 | ||||||||
| Cefoxitin EP Impurity D(Cefoxitin Lactone) | 1422023-33-3 | C15H14N2O5S2 | ||||||||
| Cefoxitin EP Impurity E (R-methoxy Cefoxitin) | 2395025-32-6 | C17H19N3O8S2 | ||||||||
| Cefoxitin EP Impurity F(S-methoxy cefoxitin) | 2395025-37-1 | C17H19N3O8S2 | ||||||||
| Cefoxitin EP Impurity G(a dimer) | N/A | C31H31N5O13S4 | ||||||||
| Cefoxitin Impurity H(Desmethoxy Cefoxitin) | 37051-05-1 | C15H15N3O6S2 | ||||||||
| Cefoxitin Impurity I | 35565-06-1 | C17H18N2O7S2 | ||||||||
| Methyl Cefoxitin | N/A | C15H16N2O5S2 | ||||||||
| Cefoxitin Demethylation Impurity | N/A | C15H15N3O7S2 | ||||||||
| Cefoxitin Oxide Impurity | N/A | C16H17N3O8S2 | ||||||||
| Cefoxitin Methyl Ester | N/A | C17H19N3O7S2 | ||||||||
| Amoxicillin | 26787-78-0 | C16H19N3O5S | ||||||||
| Amoxicillin Sodium | 34642-77-8 | C16H18N3NaO5S | ||||||||
| Amoxicilloic Acid Dimer(Mixture of Diastereomers) | 297175-66-7 | C31H40N6O9S2 | ||||||||
| Amoxicillin EP Impurity A | 551-16-6 | C8H12N2O3S | ||||||||
| Amoxicillin EP Impurity B | 26889-93-0 | C13H17N5O5S | ||||||||
| Amoxicillin EP Impurity C | 2088961-37-7,94659-47-9 (racemic) | C16H19N3O5S | ||||||||
| Amoxicillin EP Impurity D | 1642629-94-4，68728-47-2，1642559-71-4(Sodium Salt) | C16H21N3O6S | ||||||||
| Amoxicillin EP Impurity E | 1356020-01-3 | C15H21N3O4S | ||||||||
| Amoxicillin EP Impurity F | 126247-63-0 | C10H8N2O2 | ||||||||
| Amoxicillin EP Impurity G | 188112-75-6 | C24H26N4O7S | ||||||||
| Amoxicillin EP Impurity H | 106644-43-3 | C13H17NO4 | ||||||||
| Amoxicillin EP Impurity I | 22818-40-2 | C8H9NO3 | ||||||||
| Amoxicillin EP Impurity J | 94730-53-7/73590-06-4 (acid) | C32H38N6O10S2 | ||||||||
| Amoxicillin EP Impurity K | 210289-72-8 | C32H40N6O11S2 | ||||||||
| Amoxicillin EP Impurity L | 1789703-32-7 | C24H29N5O7S2(CF3COOH) | ||||||||
| Amoxicillin EP Impurity M(Amoxicillin Trimer) | 174391-69-6 | C48H57N9O15S3 | ||||||||
| Amoxicillin EP Impurity N | N/A | C48H59N9O16S3 | ||||||||
| Amoxicillin EP Impurity O | N/A | C24H31N5O8S2 | ||||||||
| Amoxicillin EP Impurity P | N/A | C17H23N3O6S | ||||||||
| Amoxicillin EP Impurity U | N/A | C18H25N3O6S | ||||||||
| Daptomycin | 103060-53-3 | C72H101N17O26 | ||||||||
| Dacpomycin Impurity 1(Dacpomycin Impurity A) | 121869-35-0 | C72H99N17O25 | ||||||||
| Anhydro Daptomycin | 121869-35-0 | C72H99N17O25 | ||||||||
| Daptomycin Impurity 3 | 883991-21-7 | C72H103N17O27 | ||||||||
| Daptomycin beta-Isomer | 123180-72-3 | C72H101N17O26 | ||||||||
| Mupirocin EP Impurity A | 40980-51-6 | C26H44O10 | ||||||||
| Mupirocin EP Impurity B | 71980-98-8 | C26H44O8 | ||||||||
| Mupirocin EP Impurity C | 85178-60-5 | C26H42O9 | ||||||||
| Mupirocin EP Impurity D | 116182-43-5 | C26H44O9 | ||||||||
| Mupirocin EP Impurity E | 116182-44-6 | C26H44O9 | ||||||||
| Mupirocin EP Impurity F | 167842-64-0 | C24H40O9 | ||||||||
| Doxycycline Monohydrate | 564-25-0 | C22H24N2O8 | ||||||||
| Doxycycline Impurity A | 3219-99-6，41411-66-9 (chloride) | C22H24N2O8 | ||||||||
| Doxycycline Impurity B | 914-00-1 | C22H22N2O8 | ||||||||
| Doxycycline Impurity C,4-epi Doxycycline | 6543-77-7 | C22H24N2O8 | ||||||||
| Doxycycline Impurity D（4-epi-6-epi-Doxycycline） | 97583-08-9 | C22H24N2O8 | ||||||||
| Doxycycline Impurity E | 79-57-2 | C22H24N2O9 | ||||||||
| Doxycycline Impurity F | 122861-53-4 | C23H25NO8 | ||||||||
| Clarithromycin | 81103-11-9 | C38H69NO13 | ||||||||
| Clarithromycin Impurity A（Clarithromycin F) | 124412-58-4 | C38H69NO14 | ||||||||
| Clarithromycin Impurity B | 299409-85-1 | C37H67NO13 | ||||||||
| Clarithromycin Impurity C | 127253-06-9 | C38H70N2O13 | ||||||||
| Clarithromycin Impurity D | 101666-68-6 | C37H67NO13 | ||||||||
| Clarithromycin Impurity E(Clarithromycin Related Compound A) | 81103-14-2 | C39H71NO13 | ||||||||
| Clarithromycin Impurity F | 128940-83-0 | C39H71NO13 | ||||||||
| Clarithromycin Impurity G | 107216-09-1 | C39H72N2O13 | ||||||||
| Clarithromycin Impurity H | 127140-69-6 | C38H67NO14 | ||||||||
| Clarithromycin Impurity I | 118058-74-5 | C30H55NO10 | ||||||||
| Clarithromycin EP Impurity J ; Roxithromycin Impurity C ; Erythromycin A (E)-9-oxime; Erythromycin A Oxime |
13127-18-9 | C37H68N2O13 | ||||||||
| Clarithromycin Impurity K | 127157-35-1 | C30H51NO8 | ||||||||
| Clarithromycin Impurity L | 127253-05-8 | C38H70N2O13 | ||||||||
| Clarithromycin Impurity M | 127182-43-8 | C37H68N2O13 | ||||||||
| Clarithromycin Impurity N | 144604-03-5 | C18H67NO12 | ||||||||
| Clarithromycin Impurity O | 127252-80-6 | C39H72N2O13 | ||||||||
| Clarithromycin Impurity P | 123967-58-8 | C39H71NO13 | ||||||||
| Clarithromycin Nitric Oxide | 118074-07-0 | C38H69NO14 | ||||||||
| Minocycline | ||||||||||
| Minocycline EP Impurity A(4-epi Minocycline) | 43168-51-0 | C23H27N3O7 | ||||||||
| Minocycline EP Impurity B | 808-26-4 | C21H22N2O7 | ||||||||
| Minocycline EP Impurity C | 4708-96-7 | C22H25N3O7 | ||||||||
| Minocycline EP Impurity D | 5679-00-5,95940-02-6(2HCl) | C21H23N3O7 | ||||||||
| Minocycline EP Impurity E | 864073-42-7 | C23H28N4O6 | ||||||||
| Minocycline EP Impurity F,HYDROXYMETHYL MINOCYCLINE | 1075240-33-3 | C24H29N3O8 | ||||||||
| Minocycline EP Impurity G | 601455-95-2 | C25H32N4O7 | ||||||||
| Ceftazidime | 78439-06-2 | C22H22N6O7S2 | ||||||||
| Ceftazidime EP Impurity A(∆2-Ceftazidime) | 1000980-60-8 | C22H22N6O7S2 | ||||||||
| Ceftazidime EP Impurity B(E-Ceftazidime) | 97148-38-4 | C22H22N6O7S2 | ||||||||
| Ceftazidime EP Impurity C (7-APCA,Ceftazidime Mother Nucleus) | 78931-25-6,96752-43-1，3432-88-0 | C13H13N3O3S | ||||||||
| Ceftazidime EP Impurity D | 73547-69-0 | C45H44N6O7S2 | ||||||||
| Ceftazidime EP Impurity E(Ceftazidime t-Butyl Ester) | 102772-66-7 | C26H30N6O7S2 | ||||||||
| Ceftazidime EP Impurity F | 110-86-1 | C5H5N | ||||||||
| Ceftazidime EP Impurity G | 194241-83-3 | C11H14N4O5S | ||||||||
| Ceftazidime EP Impurity H(Ceftazidime Methyl Ester) | 1354396-23-8 | C23H24N6O7S2 | ||||||||
| Ceftazidime Impurity K | N/A | C9H12N4O4S | ||||||||
| Ceftazidime Dimer A | N/A | C39H41N11O15S4 | ||||||||
| Ceftazidime Dimer B | N/A | C39H39N11O14S4 | ||||||||
| Ceftazidime Oxide Impurity 1 | 1301254-48-7 | C25H27N9O8S2 | ||||||||
| Ceftazidime Oxide Impurity 2 | 1301254-48-7 | C22H22N6O8S2 | ||||||||
| (6R,7S)-Ceftazidime | N/A | C22H22N6O7S2 | ||||||||
| Ceftazidime Lactone | 1301254-50-1 | C17H17N5O7S2 | ||||||||
| Ceftazidime Impurity 1 | N/A | C11H16N4O8S | ||||||||
| Ceftazidime Impurity 2 | N/A | C35H33N9O9S3 | ||||||||
| Ceftazidime Impurity 3 | N/A | C29H31N7O13S3 | ||||||||
| Ceftazidime Impurity 4 | N/A | C9H10N2O3S | ||||||||
| Ceftazidime Impurity 5 | N/A | C20H22N4O4S3 | ||||||||
| Ceftazidime Impurity 6 | N/A | C27H26N6O9S3 | ||||||||
| Ceftazidime Impurity 7 | N/A | C26H36N6O9S2 | ||||||||
| Ceftazidime Impurity 8 | N/A | C15H23N3O5S | ||||||||
| Ceftazidime Impurity 9 | 86299-47-0 | |||||||||
| Ceftazidime Impurity 10 | N/A | C13H13N3O3S | ||||||||
| Ceftazidime Impurity 11 | N/A | C13H19N3O5S | ||||||||
| Rifamycin Y | 15271-73-5 | C39H47NO15 | ||||||||
| Daptomycin | 103060-53-3 | C72H101N17O26 | ||||||||
| Dacpomycin Impurity 1(Dacpomycin Impurity A) | 121869-35-0 | C72H99N17O25 | ||||||||
| Anhydro Daptomycin，Daptomycin Impurity 2 | 121869-35-0 | C72H99N17O25 | ||||||||
| Daptomycin Impurity 3 | 883991-21-7 | C72H103N17O27 | ||||||||
| Daptomycin beta-Isomer | 123180-72-3 | C72H101N17O26 | ||||||||
| Polymyxin | 1406-11-7 | |||||||||
| Polymyxin B | 1404-26-8 | C56H98N16O13 | ||||||||
| Polymyxin B1 | 4135-11-9 | C56H98N16O13 | ||||||||
| Polymyxin B1-I | 811435-10-6 | C56H98N16O13·5CF3COOH | ||||||||
| Polymyxin B2 | 34503-87-2 | C55H96N16O13·5CF3COOH | ||||||||
| Polymyxin B3 | 71140-58-4 | C55H96N16O13·5CF3COOH | ||||||||
| Amphotericin B | C47H73NO17 | |||||||||
| Amphotericin B Impurity A,Amphotericin A (28,29-Dihydro-Amphotericin B) | 1405-32-9 | C47H75NO17 | ||||||||
| Amphotericin B Impurity B,Amphotericin X1 (13-O-Methyl Amphotericin B) | 136135-57-4 | C48H75NO17 | ||||||||
| Amphotericin B Impurity C,Amphotericin X2 (13-O-Ethyl Amphotericin B) | N/A | C49H77NO17 | ||||||||
| Amphotericin B Impurity D | N/A | C47H73NO17 | ||||||||
| Amphotericin B Impurity E | N/A | C48H73NO18 | ||||||||
| Captopril | 62571-86-2 | C9H15NO3S | ||||||||
| Captopril Impurity A(Captopril Disulfide) | 64806-05-09 | C18H28N2O6S2 | ||||||||
| Captopril Impurity B | 80629-35-2 | C9H14BrNO3 | ||||||||
| Captopril Impurity C | 26473-47-2 | C4H8O2S | ||||||||
| Captopril Impurity D | 56970-78-6 | C4H7BrO2 | ||||||||
| Captopril Impurity E | 23500-15-4 | C9H15NO3 | ||||||||
| Captopril Impurity F | 63250-36-2 | C9H15NO3S | ||||||||
| Captopril Impurity G | 76497-39-7 | C6H10O3S | ||||||||
| Captopril Impurity H | 205521-07-9 | C15H23NO5S2 | ||||||||
| Captopril Impurity I | N/A | C18H28N2O5S2 | ||||||||
| Captopril Impurity J | 64838-55-7 | C11H17NO4S | ||||||||
| Captopril Impurity L | N/A | C19H30N2O6S2 | ||||||||
| Captopril Impurity M | N/A | C13H21NO5S2 | ||||||||
| Captopril Impurity N | 65134-74-9 | C8H14O4S2 | ||||||||
| Captopril Impurity O | N/A | C21H34N2O6S2 | ||||||||
| Tetracycline Hydrochloride | 64-75-5(60-54-8) | C22H24N2O8 | ||||||||
| Tetracycline EP Impurity A | 23313-80-6 | C22H24N2O8 | ||||||||
| Tetracycline EP Impurity B | 6542-44-5 | C23H25NO8 | ||||||||
| Tetracycline EP Impurity C | N/A | C22H22N2O7 | ||||||||
| Tetracycline EP Impurity D (Chlortetracycline EP Impurity I, Lymecycline EP Impurity D, 4-Epianhydrotetracycline) | 4465-65-0,7518-17-4(free base) | C22H22N2O7 | ||||||||
| Digoxin EP Impurity E | 52589-12-5 | C41H64O15 | ||||||||
| Digoxin EP Impurity G | 55576-67-5 | C41H64O14 | ||||||||
| Digoxin EP Impurity K | 31539-05-6 | C47H74O17 | ||||||||
| Valacyclovir | 124832-26-4 | C13H20N6O4 | ||||||||
| Valacyclovir Impurity C( EP)，Valacyclovir USP Related Compound C | 1346747-65-6 | C14H22N6O4 | ||||||||
| Valacyclovir Impurity D( EP) | 1346747-69-0 | C15H24N6O4 | ||||||||
| Valacyclovir Impurity E( EP) | 124832-31-1 | C21H26N6O6 | ||||||||
| Valacyclovir Impurity H (EP) | 84499-64-9 | C11H16N6O4 | ||||||||
| Valacyclovir Impurity Ｊ( EP) | N/A | C14H22N6O4 | ||||||||
| Valacyclovir Impurity M( EP) | 847670-62-6 | C14H20N6O5 | ||||||||
| Cefepime | 88040-23-7，123171-59-5(Dihydrochloride Monohydrate) | C19H24N6O5S2 | ||||||||
| Cefepime Impurity A,Anti-Cefepime | 97164-57-3(free base); 149261-27-8(carboxylic acid) | C19H24N6O5S2 | ||||||||
| Cefepime Impurity B | N/A | C25H30N9O7S3+ | ||||||||
| Cefepime Impurity C | 104301-63-5 | C8H10N4O3S;C8H12N4O4S | ||||||||
| Cefepime Impurity D | 65872-41-5 | C6H7N3O3S | ||||||||
| Cefepime Impurity E | 103296-32-8 | C13H19N3O3S | ||||||||
| Cefepime Impurity F | N/A | C32H42N9O7S3+ | ||||||||
| △3-Cefepime | 112258-89-6 | C19H24N6O5S2 | ||||||||
| (6R,7S)-Cefepime | N/A | C19H24N6O5S2 | ||||||||
| Cefepime Oxide Impurity | N/A | C19H24N6O6S2 | ||||||||
| Cefepime Dimer | N/A | C33H37N11O10S4 | ||||||||
| Cefepime Impurity 1 | N/A | C25H29N9O7S3 | ||||||||
| Cefepime Impurity 2 | N/A | C25H33N7O8S2 | ||||||||
| Cefepime Impurity 3 | N/A | C27H31N8O7S3 | ||||||||
| Cefditoren Pivoxil | 117467-28-4 | C25H28N6O7S3 | ||||||||
| Cefditoren Pivoxil Impurity A(Cefditoren) | 104145-95-1(free base 104146-53-4(Sodium Salt) | C19H18N6O5S3 | ||||||||
| Cefditoren Pivoxil Impurity B(Cefditoren Pivoxil Open-Ring Impurity) | 138514-32-6 | C25H30N6O8S3 | ||||||||
| Cefditoren Pivoxil Impurity C(Cefetamet Pivoxil) | 65243-33-6 | C20H25N5O7S2 | ||||||||
| Cefditoren Pivoxil Impurity D(Δ3-Cefditoren Pivoxil) | 148774-47-4 | C25H28N6O7S3 | ||||||||
| Cefditoren Pivoxil Impurity E | N/A | C27H32N6O8S3 | ||||||||
| Cefditoren Pivoxil Impurity F(3E-Cefditoren Pivoxil) | 138514-32-6 | C25H28N6O7S3 | ||||||||
| Pivoxil Impurity G(Cefditoren Dual Ester,Cefditoren Dipivoxil) | N/A | C31H38N6O9S3 | ||||||||
| Cefditoren Pivoxil Impurity H | N/A | C30H36N6O8S3 | ||||||||
| Cefditoren Pivoxil Impurity I(Cefditoren Pivoxil Dimer) | N/A | C51H56N12O14S6 | ||||||||
| Cefditoren Pivoxil Impurity J(Cefditoren Pivoxil Open-Ring Dimer) | N/A | C50H56N12O14S6 | ||||||||
| Cefditoren Pivoxil Oxide Impurity | N/A | C25H28N6O8S3 | ||||||||
| Cefditoren Pivoxil impurity 15 | 145904-68-3 | C19H18N6O5S3 | ||||||||
| Cefditoren Pivoxil impurity 16 | N/A | C31H40N6O10S3 | ||||||||
| Cefditoren Pivoxil Impurity 18(Cefditoren Pivoxil parent nucleus) | N/A | C19H23N3O5S2 | ||||||||
| 7E-Cefditoren Pivoxil | 878002-86-9 | C25H28N6O7S3 | ||||||||
| Δ3-Cefditoren Pivoxil Mother Nucleus | N/A | C13H13N3O3S2 | ||||||||
| Cephalexin | 15686-71-2(Cephalexin monohydrate CAS No:23325-78-2) | C16H17N3O4S | ||||||||
| Cephalexin Impurity A(EP) | 875-74-1 | C8H9NO2 | ||||||||
| Cephalexin Impurity B(EP) | 22252-43-3 | C8H10N2O3S | ||||||||
| Cephalexin Impurity C(EP) | 72528-40-6 | C24H24N4O5S | ||||||||
| Cephalexin EP Impurity D | 34876-35-2 | C5H6O2S | ||||||||
| Cephalexin Impurity E(EP), | 146794-70-9 | C13H18N2O4S | ||||||||
| Cephalexin Impurity F(EP) | 79750-46-2 | C16H17N3O4S | ||||||||
| Vancomycin | ||||||||||
| Vancomycin EP Impurity A | 91700-98-0 | C65H73Cl2N9O24 | ||||||||
| Vancomycin EP Impurity B | 55598-85-1 | C66H74Cl2N8O25 | ||||||||
| Vancomycin EP Impurity C | 82198-76-3 | C53H52Cl2N8O17 | ||||||||
| Vancomycin EP Impurity D | 101485-50-1 | C59H62Cl2N8O22 | ||||||||
| Rifaximin Impurity G(EP) | 80621-76-7 | C43H49N3O11 | ||||||||
| Rifaximin Impurity D(EP) | N/A | C43H49N3O12 | ||||||||
| Rifaximin Impurity G(EP) | 80621-76-7 | C43H49N3O11 | ||||||||
| Rifaximin Impurity H(EP) | 1210022-90-4 | C43H51N3O12 | ||||||||
| Spiramycin I | N/A | C43H74N2O14 | ||||||||
| Spiramycin EP Impurity A | N/A | C36H62N2O11 | ||||||||
| Spiramycin EP Impurity B | 249930-66-3 | C43H76N2O14 | ||||||||
| Spiramycin EP Impurity C | 177584-13-3 | C44H74N2O14 | ||||||||
| Spiramycin EP Impurity D | 87708-39-2 | C42H71NO16 | ||||||||
| Spiramycin EP Impurity E | N/A | C43H76N2O13 | ||||||||
| Spiramycin EP Impurity F (Spiramycin Dimer) | N/A | C84H140N4O26 | ||||||||
| Spiramycin EP Impurity G(Neospiramycin II) | N/A | C38H64N2O12 | ||||||||
| Spiramycin EP Impurity H (Neospiramycin III) | N/A | C39H66N2O12 | ||||||||
| Ivermectin | 70288-86-7 | C17H16F3N3O3S | ||||||||
| Ivermectin EP Impurity A | N/A | C48H72O14 | ||||||||
| Ivermectin EP Impurity B,Abamectin B1b | 65195-56-4 | C47H70O14 | ||||||||
| Ivermectin EP Impurity C（Avermectin B2a ） | 65195-57-5 | C48H74O15 | ||||||||
| Ivermectin EP Impurity D | 102190-55-6 | C48H72O15 | ||||||||
| Ivermectin EP Impurity E | N/A | C49H76O14 | ||||||||
| Ivermectin EP Impurity F | N/A | C48H74O14 | ||||||||
| Ivermectin Impurity G(EP) | 73162-95-5 | C34H50O8 | ||||||||
| Ivermectin Impurity H(EP) | 71837-27-9 | C41H62O11 | ||||||||
| Ivermectin EP Impurity I | 1135339-49-9 | C48H74O14 | ||||||||
| Ivermectin EP Impurity J | N/A | C47H72O14 | ||||||||
| Ivermectin EP Impurity K | 74567-01-4 | C48H76O14 | ||||||||
| Acyclovir(Aciclovir) | 59277-89-3 | C8H11N5O3 | ||||||||
| Acyclovir EP Impurity A | 102728-64-3 | C10H13N5O4 | ||||||||
| Acyclovir EP Impurity B | 73-40-5 | C5H5N5O | ||||||||
| Acyclovir EP Impurity C | 91702-61-3 | C8H11N5O3 | ||||||||
| Acyclovir EP Impurity D(Acyclovir Benzoate) | 59277-91-7 | C15H15N5O4 | ||||||||
| Acyclovir EP Impurity E | 374697-95-7 | C8H11N5O3 | ||||||||
| Acyclovir EP Impurity F | 110104-37-5 | C10H13N5O4 | ||||||||
| Acyclovir EP Impurity G | 75128-73-3 | C12H15N5O5 | ||||||||
| Acyclovir EP Impurity H | 133186-23-9 | C17H17N5O5 | ||||||||
| Acyclovir EP Impurity I | 1797832-75-7 | C14H16N10O4 | ||||||||
| Acyclovir EP Impurity J | 166762-90-9 | C14H16N10O4 | ||||||||
| Acyclovir EP Impurity K | 1797131-64-6 | C17H22N10O6 | ||||||||
| Acyclovir EP Impurity L | 3056-33-5 | C9H9N5O3 | ||||||||
| Acyclovir EP Impurity M | 91702-60-2 | C12H15N5O5 | ||||||||
| Acyclovir EP Impurity O(N-Hydroxymethyl Acyclovir) | 2190509-40-9 | C9H13N5O4 | ||||||||
| Acyclovir EP Impurity P | 23169-33-7 | C7H9N5O2 | ||||||||
| Acyclovir EP Impurity R | N/A | C17H22N10O6 | ||||||||
| Azithromycin | 83905-01-5 | C38H72N2O12 | ||||||||
| Azithromycin Impurity A | 76801-85-9 | C39H74N2O12 | ||||||||
| Azithromycin Impurity B | 307974-61-4 | C38H72N2O11 | ||||||||
| Azithromycin Impurity C | 620169-47-3 | C37H70N2O12 | ||||||||
| Azithromycin Impurity D | 612069-26-8 | C38H72N2O13 | ||||||||
| Azithromycin Impurity E | 612069-27-9 | C38H72N2O12 | ||||||||
| Azithromycin Impurity F | 612069-28-0 | C38H70N2O13 | ||||||||
| Azithromycin Impurity G | 612069-31-5 | C44H76N2O14S | ||||||||
| Azithromycin Impurity H | 612069-30-4 | C45H77N3O15S | ||||||||
| Azithromycin Impurity I | 172617-84-4 | C37H70N2O12 | ||||||||
| Azithromycin Impurity J | 117693-41-1 | C30H58N2O9 | ||||||||
| Azithromycin Impurity K | N/A | C38H70N2O13 | ||||||||
| Azithromycin Impurity L | 90503-06-3 | Chemical Formula: C38H72N2O13 | ||||||||
| Azithromycin Impurity M | 765927-71-7 | C37H68N2O13 | ||||||||
| Azithromycin Impurity N | 612069-25-7 | C36H65NO13 | ||||||||
| Azithromycin Impurity O | 763924-54-5 | C39H74N2O12 | ||||||||
| Azithromycin Impurity 1 | N/A | C36H65NO12 | ||||||||
| Azithromycin Impurity 2 | N/A | C43H74N2O14S | ||||||||
| Azithromycin Impurity 3 | N/A | C43H74N2O14S | ||||||||
| Atorvastatin | 134523-00-5 | C33H35FN2O5 | ||||||||
| Atorvastatin EP Impurity A,Desfluoroatorvastatin | 433289-84-0 | C33H36N2O5 | ||||||||
| Atorvastatin EP Impurity B | N/A | C33H35FN2O5 | ||||||||
| Atorvastatin EP Impurity C | N/A | C33H34F2N2O5 | ||||||||
| Atorvastatin EP Impurity D(Atorvastatin USP Related Compound D) | 148146-51-4 | C26H22FNO4 | ||||||||
| Atorvastatin EP Impurity E | N/A | C33H35FN2O5 | ||||||||
| Atorvastatin EP Impurity F | 1105067-87-5(1/2Ca Salt),887196-24-9 (free acid),1371615-56-3(Sodium Salt) | C40H48FN3O8 | ||||||||
| Atorvastatin EP Impurity G | 887196-29-4 | C34H37FN2O5 | ||||||||
| Atorvastatin EP Impurity H | 125995-03-1 | C33H33FN2O4 | ||||||||
| 3-Oxo Atorvastatin Sodium Salt | Rac：1391052-00-8 | C33H32FN2O5. Na | ||||||||
| 3-Oxo Atorvastatin | R-isomer：887196-30-7 | C33H33FN2O5 | ||||||||
| Atorvastatin lactone dicyclic oxide,Atorvastatin Lactone Diepoxide(Mixture of diastereomers) | 1046118-40-4 | C33H33FN2O6 | ||||||||
| Atorvastatin impurity 226 | 947262-20-6 | C₃₇H₄₁FN₂O₅ | ||||||||
| Atorvastatin impurity 205(3-Oxo Atorvastatin tert-Butyl Ester) | 134394-98-2 | C37H41FN2O5 | ||||||||
| Amlodipine-Atorvastatin Dimer(Mixture of Diastereomers) | 425408-16-8 | C53H58ClFN4O9 | ||||||||
| Atorvastatin cypropyl impurity,Atorvastatin Cyclic Sodium Salt(Isopropyl) Impurity | 873950-17-5(free acid);1316291-19-6 | C33H34FN2O7.Na(C33H34FN2NaO7) | ||||||||
| Atorvastatin ring impurity (fluorophenyl),Atorvastatin Cyclic Sodium Salt (Fluorophenyl) Impurity | 873950-18-6(free acid ),1315629-79-8 | C₃₃H₃₄FN₂NaO₇ | ||||||||
| Atorvastatin methyl ester | 345891-62-5 | C34H37FN2O5 | ||||||||
| Atorvastatin lactam sodium salt impurity | 148217-40-7 Alternate CAS #906552-18-9-free acid |
C33H34FN2O6 Na | ||||||||
| Atorvastatin circulating sodium salt (isopropyl) impurity | 1316291-19-6 Alternate CAS #873950-17-5 free acid |
C33H34FN2O7. Na(C₃₃H₃₄FN₂NaO₇) | ||||||||
| Atorvastatin impurity 1(Atorvastatin USP Related Compound B) | 887196-25-0 Alternate CAS #Free Acid: 887324-52-9 |
C33H35FN2O5 | ||||||||
| Atorvastatin Epoxy Tetrahydrofuran Impurity | 873950-19-7 | C26H24FNO5 | ||||||||
| Ampicillin | 69-53-4 | C16H19N3O4S | ||||||||
| Ampicillin EP Impurity A | 551-16-6 | C8H12N2O3S | ||||||||
| Ampicillin EP Impurity B(L-Ampicillin) | 19379-33-0 | C16H19N3O4S | ||||||||
| Ampicillin EP Impurity C(Ampicillin Diketopiperazine) | 49841-96-5 | C16H19N3O4S | ||||||||
| Ampicillin EP Impurity D | 1642629-93-3,32746-94-4 | C16H21N3O5S | ||||||||
| Ampicillin EP Impurity E | N/A | C24H26N4O5S | ||||||||
| Ampicillin EP Impurity F | N/A | C15H21N3O3S | ||||||||
| Ampicillin EP Impurity G | 31485-02-6 | C16H14N2O2 | ||||||||
| Ampicillin EP Impurity H | N/A | C10H8N2O | ||||||||
| Ampicillin EP Impurity I | N/A | C24H26N4O5S | ||||||||
| Ampicillin EP Impurity J | 6489-58-3 | C13H20N2O4S | ||||||||
| Ampicillin EP Impurity K | N/A | C13H17NO3 | ||||||||
| Ampicillin EP Impurity L | N/A | C8H9NO2 | ||||||||
| Ampicillin EP Impurity M | 94730-51-5,62326-82-3(Disodium Salt) | C32H38N6O8S2 | ||||||||
| Ampicillin EP Impurity N | N/A | C16H19N3O4S | ||||||||
| Ampicillin Open-Ring Dimer | N/A | C32H40N6O9S2 | ||||||||
| Ampicillin Closed-Ring Dimer | N/A | C34H41N5O8S | ||||||||
| Ampicillin EP Impurity Q | N/A | C48H57N9O12S3 | ||||||||
| Ampicillin EP Impurity R | N/A | C24H29N5O6S2 | ||||||||
| Ampicillin EP Impurity S | N/A | C24H29N5O6S2 | ||||||||
| Amlodipine | 88150-42-9 | C20H25ClN2O5 | ||||||||
| Amlodipine EP Impurity A | 88150-62-3 | C28H27ClN2O7 | ||||||||
| Amlodipine EP Impurity B | 721958-72-1 | C29H32ClN3O7 | ||||||||
| Amlodipine EP Impurity C | 721958-74-3 | C22H30ClN3O6 | ||||||||
| Amlodipine EP Impurity D( Amlodipine Related Compound A) | 113994-41-5(free base),2138811-33-1(fumarate) | C20H23ClN2O5 | ||||||||
| Amlodipine EP Impurity E | 140171-65-9 (free base),400024-12-6(Maleate) | C21H27ClN2O5 | ||||||||
| Amlodipine EP Impurity F | 140171-66-0 | C19H23ClN2O5 | ||||||||
| Amlodipine EP Impurity G | 43067-01-2 | C17H18ClNO4 | ||||||||
| Amlodipine EP Impurity H | 318465-73-5 | C28H29ClN2O8 | ||||||||
| Amikacin Sulphate | 39831-55-5 | C22H43N5O12 | ||||||||
| Amikacin Sulphate Impurity A | N/A | C22H43N5O12 | ||||||||
| Amikacin Sulphate Impurity B | 927821-99-6 | C26H50N6O14 | ||||||||
| Amikacin Sulphate Impurity C | 50725-25-2 | C22H43N5O12 | ||||||||
| Amikacin Sulphate Impurity D | 59-01-8 | C18H36N4O10 | ||||||||
| Amikacin Sulphate Impurity E | N/A | C22H43N5O12 | ||||||||
| Amikacin Sulphate Impurity F | 197909-67-4 | C26H50N6O14 | ||||||||
| Amikacin Sulphate Impurity G | 50896-99-6 | C22H43N5O12 | ||||||||
| Amikacin Sulphate Impurity H | 48237-20-3 | C22H43N5O12 | ||||||||
| Amikacin Sulphate Impurity I | 40371-51-5 | C4H9NO3 | ||||||||
| Arbidol | 131707-25-0 | C22H25BrN2O3S | ||||||||
| Arbidol Sulfoxide | 151455-33-3 | C22H25BrN2O4S | ||||||||
| Arbidol Sulfone | 151455-32-2 | C22H25BrN2O5S | ||||||||
| Abidol Hydrolysis Impurity | N/A | C20H21BrN2O3S | ||||||||
| Arbidol Impurity 1 | 1130901-04-0 | C21H23BrN2O3S | ||||||||
| Arbidol Impurity 2 | 25900-97-4 | C22H26N2O3S | ||||||||
| Arbidol Impurity 3 | 958450-23-2 | C22H23BrN2O3S | ||||||||
| Arbidol Impurity 4 | 40945-79-7 | C15H17NO4 | ||||||||
| Apixaban | 503612-47-3 | C25H25N5O4 | ||||||||
| Apixaban Amino Acid Impurity | 2206825-87-6 | C25H27N5O5 | ||||||||
| Buspirone HCl | 33386-08-2 | C21H32ClN5O2(C21H31N5O2.HCl) | ||||||||
| Buspirone EP Impurity A | 20980-22-7 | C8H12N4 | ||||||||
| Buspirone EP Impurity B | 81461-72-5 | C12H19N4.Cl | ||||||||
| Buspirone EP Impurity C | 257877-45-5 | C20H30N8 | ||||||||
| Buspirone EP Impurity D | N/A | C24H38N8O | ||||||||
| Buspirone EP Impurity E | 257877-46-6 (HCl Salt) | C21H33N5O3 | ||||||||
| Buspirone EP Impurity F | N/A | C33H51N9O3 | ||||||||
| Buspirone EP Impurity G | CAS No. 84746-24-7 | C12H14N6 | ||||||||
| Buspirone EP Impurity H | N/A | C33H50N8O4 | ||||||||
| Buspirone EP Impurity I | N/A | C21H30ClN5O2 | ||||||||
| Buspirone EP Impurity J | N/A | C34H52N6O5 | ||||||||
| Buspirone EP Impurity K | 1075-89-4 | C9H13NO2 | ||||||||
| Clindamycin | 18323-44-9 | C18H33ClN2O5S | ||||||||
| Clindamycin Hydrochloride | 21462-39-5 | C18H33ClN2O5S | ||||||||
| Clindamycin Phosphate EP Impurity A(Lincomycin) | 154-21-2(859-18-7 HCl salt) | C18H34N2O6S | ||||||||
| Clindamycin Phosphate EP Impurity B(Clindamycin B 2-Phosphate) | 54887-31-9 | C17H32ClN2O8PS | ||||||||
| Clindamycin Phosphate EP Impurity C,Clindamycin 3-Phosphate | 28708-34-1 | C18H34ClN2O8PS | ||||||||
| Clindamycin Phosphate EP Impurity D | 54887-30-8 | C18H34ClN2O8PS | ||||||||
| Clindamycin Phosphate EP Impurity E(Clindamycin Hydrochloride) | 21462-39-5 | C18H33ClN2O5S | ||||||||
| Clindamycin Phosphate EP Impurity F,Lincomycin 2-Phosphate | 27480-30-4 | C18H35N2O9PS | ||||||||
| Clindamycin Phosphate EP Impurity G(Lincomycin 2,4-Phosphate) | CAS No:N/A | C18H33N2O8PS | ||||||||
| Clindamycin Phosphate EP Impurity H(Clindamycin 2,3-Bisphosphate) | N/A | C18H35ClN2O11P2S | ||||||||
| Clindamycin Phosphate EP Impurity I(Clindamycin 2,4-Bisphosphate) | 1309048-48-3 | C18H35ClN2O11P2S | ||||||||
| Clindamycin Phosphate EP Impurity J(Dehydroclindamycin Phosphate) | 1309349-64-1 | C18H32ClN2O8PS | ||||||||
| Clindamycin Phosphate EP Impurity K | CAS No:N/A | Chemical Formula:C36H66Cl2N4O15P2S2 | ||||||||
| Clindamycin Phosphate EP Impurity L(7-Epi Clindamycin 2-Phosphate) | CAS No:620181-05-7 | C18H34ClN2O8PS | ||||||||
| Clindamycin Phosphate α-Isomer(Clindamycin Phosphate Impurity 12，Clindamycin Diastereomer 2-Phosphate） | 1800297-62-4 | C18H34ClN2O8PS | ||||||||
| Cefpodoxime Proxetil(Mixture of Diastereomers) | 87239-81-4 | C21H27N5O9S2 | ||||||||
| Cefpodoxime Proxetil EP Impurity A(Cefpodoxime Acid) | 80210-62-4 | C15H17N5O6S2 | ||||||||
| Cefpodoxime Proxetil EP Impurity B | 947692-14-0 | C20H25N5O8S2 | ||||||||
| Cefpodoxime Proxetil EP Impurity C | 339528-86-8 | C21H27N5O9S2 | ||||||||
| Cefpodoxime Proxetil EP Impurity D | 947692-13-9 | C21H27N5O9S2 | ||||||||
| Cefpodoxime Proxetil EP Impurity E | 217803-89-9 | C22H27N5O10S2 | ||||||||
| Cefpodoxime Proxetil EP Impurity F | 96680-30-7 | C22H27N5O10S2 | ||||||||
| Cefpodoxime Proxetil Impurity G | 947692-15-1 | C23H29N5O10S2 | ||||||||
| Cefpodoxime Proxetil EP Impurity H(cefpodoxime proxetil dimer) | 947692-16-2 | C42H54N10O18S4 | ||||||||
| Cefpodoxime Proxetil Impurity I | N/A | C25H33N5O11S2 | ||||||||
| Cefpodoxime Proxetil Impurity J(Cefpodoxime Proxetil Oxide Impurity) | N/A | C21H27N5O10S2 | ||||||||
| Cefpodoxime Proxetil Impurity K(Cefpodoxime Proxetil Trans-Oxide Impurity) | N/A | C21H27N5O10S2 | ||||||||
| Δ3-Cefpodoxime | N/A | C15H17N5O6S2 | ||||||||
| Cefpodoxime Proxetil Impurity 1 | N/A | C25H33N5O11S2 | ||||||||
| Cefpodoxime Proxetil Impurity 2 | N/A | C35H40N10O14S4 | ||||||||
| Cefpodoxime Proxetil Impurity 3 | N/A | C36H40N10O14S4 | ||||||||
| 7-AMCA | 24701-69-7 | C9H12N2O4S | ||||||||
| Cefuroxime Sodium | 56238-63-2 | C16H15N4NaO8S | ||||||||
| Cefuroxime Impurity A | 56271-94-4 | C15H15N3O7S | ||||||||
| Cefuroxime Impurity B | 39685-31-9 | C17H17N3O8S | ||||||||
| Cefuroxime Impurity C | 69822-88-4 | C15H15N3O6S | ||||||||
| Cefuroxime Impurity D | 76598-06-6 | C18H15Cl3N4O9S | ||||||||
| Cefuroxime Impurity E | 97232-97-8 | C16H16N4O8S | ||||||||
| Cefuroxime Impurity F | 97170-19-9 | C15H15N3O7S | ||||||||
| Cefuroxime Impurity G | 97232-98-9 | C17H17N3O8S | ||||||||
| Cefuroxime Impurity H | 947723-87-7 | C15H13N3O6S | ||||||||
| Cefuroxime Impurity I | 39684-61-2，97148-39-5（Ammonium Salt） | C7H7NO4 | ||||||||
| Cefuroxime Oxide Impurity 1 | 929531-94-2 | C16H16N4O9S | ||||||||
| Cefuroxime Oxide Impurity 2 | N/A | C16H16N4O9S | ||||||||
| 7S-Cefuroxime | N/A | C16H16N4O8S | ||||||||
| △3-Cefuroxime | 229499-08-5 | C16H16N4O8S | ||||||||
| Cefuroxime Axetil | 64544-07-6 | C20H22N4O10S | ||||||||
| Cefuroxime Axetil Impurity A | 123458-61-7 | C20H22N4O10S | ||||||||
| Cefuroxime Axetil Impurity B | 97232-96-7 | C20H22N4O10S | ||||||||
| Cefuroxime Axetil Impurity C | 76598-06-6 | C18H15Cl3N4O9S | ||||||||
| Cefuroxime Axetil Impurity D | 55268-75-2 | C16H16N4O8S | ||||||||
| Cefuroxime Axetil Impurity E | 947723-87-7 | C15H13N3O6S | ||||||||
| Cefuroxime Axetil Impurity F | N/A | C19H21N3O8S | ||||||||
| Cefuroxime Axetil Impurity G | N/A | C21H33N3O10S | ||||||||
| Cefuroxime Axetil Oxide Impurity | N/A | C20H22N4O11S | ||||||||
| Cefuroxime Axetil Dimer | 1202925-10-7? | C36H38N8O17S2 | ||||||||
| Cefaclo | 70356-03-5 | C15H14ClN3O4S | ||||||||
| Cefaclor EP Impurity A | 875-74-1 | C8H9NO2 | ||||||||
| Cefaclor EP Impurity B | 53994-69-7 | C7H7ClN2O3S | ||||||||
| Cefaclor EP Impurity C | 143059-69-2 | C15H14ClN3O4S | ||||||||
| Cefaclor EP Impurity D | 152575-13-8 | C15H14ClN3O4S | ||||||||
| Cefaclor EP Impurity E | 188915-50-6 | C14H14ClN3O4S | ||||||||
| Cefaclor EP Impurity F | 73200-73-4 | C10H8N2O | ||||||||
| Cefditoren Pivoxil | 117467-28-4 | C25H28N6O7S3 | ||||||||
| Cefditoren Pivoxil Impurity A(Cefditoren) | 104145-95-1(free base 104146-53-4(Sodium Salt) | C19H18N6O5S3 | ||||||||
| Cefditoren Pivoxil Impurity B(Cefditoren Pivoxil Open-Ring Impurity) | 138514-32-6 | C25H30N6O8S3 | ||||||||
| Cefditoren Pivoxil Impurity C(Cefetamet Pivoxil) | 65243-33-6 | C20H25N5O7S2 | ||||||||
| Cefditoren Pivoxil Impurity D(Δ3-Cefditoren Pivoxil) | 148774-47-4 | C25H28N6O7S3 | ||||||||
| Cefditoren Pivoxil Impurity E | N/A | C27H32N6O8S3 | ||||||||
| Cefditoren Pivoxil Impurity F(3E-Cefditoren Pivoxil) | 138514-32-6 | C25H28N6O7S3 | ||||||||
| Pivoxil Impurity G(Cefditoren Dual Ester,Cefditoren Dipivoxil) | N/A | C31H38N6O9S3 | ||||||||
| Cefditoren Pivoxil Impurity H | N/A | C30H36N6O8S3 | ||||||||
| Cefditoren Pivoxil Impurity I(Cefditoren Pivoxil Dimer) | N/A | C51H56N12O14S6 | ||||||||
| Cefditoren Pivoxil Impurity J(Cefditoren Pivoxil Open-Ring Dimer) | N/A | C50H56N12O14S6 | ||||||||
| Cefditoren Pivoxil Oxide Impurity | N/A | C25H28N6O8S3 | ||||||||
| Cefditoren Pivoxil impurity 15 | 145904-68-3 | C19H18N6O5S3 | ||||||||
| Cefditoren Pivoxil impurity 16 | N/A | C31H40N6O10S3 | ||||||||
| Cefditoren Pivoxil Impurity 18(Cefditoren Pivoxil parent nucleus) | N/A | C19H23N3O5S2 | ||||||||
| 7E-Cefditoren Pivoxil | 878002-86-9 | C25H28N6O7S3 | ||||||||
| Δ3-Cefditoren Pivoxil Mother Nucleus | N/A | C13H13N3O3S2 | ||||||||
| Cefradine | 38821-53-3 | C16H19N3O4S | ||||||||
| Cefradine Impurity A (EP),7-ADCA | 22252-43-3 | C8H10N2O3S | ||||||||
| Cefradine Impurity B(EP) | 26774-88-9 | C8H11NO2 | ||||||||
| Cefradine Impurity C (EP) | N/A | C16H19N3O5S | ||||||||
| Cefradine Impurity D (EP)，(Isomer 2) | N/A | C16H19N3O5S | ||||||||
| Cefradine Impurity E (EP) | 215172-75-1 | C16H17N3O5S | ||||||||
| Cefradine EP Impuity F(Cephalexin EP Impurity D,Cefadroxil EP Impurity G) | 34876-35-2 | C5H6O2S | ||||||||
| Cefradine Impurity G(EP),（7-ADCA pivalamide ） | 146794-70-9 | C13H18N2O4S | ||||||||
| 4′,5′-Dihydrocephradine | 37051-00-6 | C16H21N3O4S | ||||||||
| Tetrahydro-Cefradine | N/A | C16H23N3O4S | ||||||||
| (△3)-Cefradine | N/A | C16H19N3O4S | ||||||||
| Cefradine Open-Ring Impurity | N/A | C16H21N3O5S | ||||||||
| Cefradine Dimer | N/A | C32H36N6O7S2 | ||||||||
| Cefradine Dioxide Impurity | N/A | C16H19N3O6S | ||||||||
| Clarithromycin | 81103-11-9 | C38H69NO13 | ||||||||
| Clarithromycin Impurity A（Clarithromycin F?) | 124412-58-4 | C38H69NO14 | ||||||||
| Clarithromycin Impurity B | 299409-85-1 | C37H67NO13 | ||||||||
| Clarithromycin Impurity C | 127253-06-9 | C38H70N2O13 | ||||||||
| Clarithromycin Impurity D | 101666-68-6 | C37H67NO13 | ||||||||
| Clarithromycin Impurity E(Clarithromycin Related Compound A) | 81103-14-2 | C39H71NO13 | ||||||||
| Clarithromycin Impurity F | 128940-83-0 | C39H71NO13 | ||||||||
| Clarithromycin Impurity G | 107216-09-1 | C39H72N2O13 | ||||||||
| Clarithromycin Impurity H | 127140-69-6 | C38H67NO14 | ||||||||
| Clarithromycin Impurity I | 118058-74-5 | C30H55NO10 | ||||||||
| Clarithromycin EP Impurity J ; Roxithromycin Impurity C ; Erythromycin A (E)-9-oxime; Erythromycin A Oxime |
13127-18-9 | C37H68N2O13 | ||||||||
| Clarithromycin Impurity K | 127157-35-1 | C30H51NO8 | ||||||||
| Clarithromycin Impurity L | 127253-05-8 | C38H70N2O13 | ||||||||
| Clarithromycin Impurity M | 127182-43-8 | C37H68N2O13 | ||||||||
| Clarithromycin Impurity N | 144604-03-5 | C18H67NO12 | ||||||||
| Clarithromycin Impurity O | 127252-80-6 | C39H72N2O13 | ||||||||
| Clarithromycin Impurity P | 123967-58-8 | C39H71NO13 | ||||||||
| Clarithromycin Nitric Oxide | 118074-07-0 | C38H69NO14 | ||||||||
| Doxycycline Monohydrate | 564-25-0 | C22H24N2O8 | ||||||||
| Doxycycline Impurity A | 3219-99-6，41411-66-9 (chloride) | C22H24N2O8 | ||||||||
| Doxycycline Impurity B | 914-00-1 | C22H22N2O8 | ||||||||
| Doxycycline Impurity C,4-epi Doxycycline | 6543-77-7 | C22H24N2O8 | ||||||||
| Doxycycline Impurity D（4-epi-6-epi-Doxycycline） | 97583-08-9 | C22H24N2O8 | ||||||||
| Doxycycline Impurity E | 79-57-2 | C22H24N2O9 | ||||||||
| Doxycycline Impurity F | 122861-53-4 | C23H25NO8 | ||||||||
| Droperidol | 548-73-2 | C22H22FN3O2 | ||||||||
| Droperidol EP Impurity A | 2147-83-3 | C12H13N3O | ||||||||
| Droperidol EP Impurity B | 1026015-45-1 | C22H22FN3O2 | ||||||||
| Droperidol EP Impurity C | 60373-76-4 | 2H19ClFN3O2(C22H19FN3O2.Cl) | ||||||||
| Droperidol EP Impurity D | 466118-75-2 | C22H22FN3O3 | ||||||||
| Droperidol EP Impurity E | 1346604-17-8 | C34H34N6O3 | ||||||||
| Daptomycin | 103060-53-3 | C72H101N17O26 | ||||||||
| Daptomycin beta-Isomer | 123180-72-3 | C72H101N17O26 | ||||||||
| Dexamethasone Sodium Phosphate | C22H28FNa2O8P | |||||||||
| Dexamethasone Sodium Phosphate EP Impurity F | C22H30FO8P | |||||||||
| Famotidine | 76824-35-6 | C8H15N7O2S3 | ||||||||
| Famotidine EP Impurity A | 124646-10-2124646-10-2 (free base) ，76833-47-1（chlorine） | C8H14N6S2 | ||||||||
| Famotidine EP Impurity B | 89268-62-2 | C16H23N11O2S5 | ||||||||
| Famotidine EP Impurity C | 76824-17-4，Alternate CAS #:106433-44-7 for free base | C8H14N6O3S3 | ||||||||
| Famotidine EP Impurity D | 76824-16-3 | C8H13N5OS2 | ||||||||
| Famotidine EP Impurity E | 129083-44-9 | C10H14N8S4 | ||||||||
| Famotidine EP Impurity F | 107880-74-0 | C8H12N4O2S2 | ||||||||
| Famotidine EP Impurity G | 76823-97-7 | C9H13N7S2 | ||||||||
| Famotidine EP Impurity H | 88046-01-9，Alternate Cas No.106649-96-1（free base） | C6H10N6S2 | ||||||||
| Famotidine EP Impurity I | 1020719-36-1 | C8H14N6O4S3 | ||||||||
| Famotidine EP Impurity J | 76824-14-1 .1798006-30-0(chloride) | C9H14N4O2S2 | ||||||||
| Famotidine Sulfoxide | 90237-03-9 | C8H15N7O3S3 | ||||||||
| Hydrocortisone | 50-23-7 | C21H30O5 | ||||||||
| Hydrocortisone Impurity A | CAS No:50-24-8 | C21H28O5 | ||||||||
| Hydrocortisone EP Impurity B | CAS No:53-06-5 | C21H28O5 | ||||||||
| Hydrocortisone EP Impurity C | CAS No:50-03-3 | C23H32O6 | ||||||||
| Hydrocortisone EP Impurity D | 53-35-0 | C21H30O6 | ||||||||
| Hydrocortisone EP Impurity E | 600-99-7 | C21H28O5 | ||||||||
| Hydrocortisone EP Impurity F | 152-58-9 | C21H30O4 | ||||||||
| Hydrocortisone EP Impurity G | 14760-49-7 | C21H28O5 | ||||||||
| Hydrocortisone EP Impurity H | N/A | C21H30O6 | ||||||||
| Hydrocortisone EP Impurity I | 103795-84-2 | C21H30O6 | ||||||||
| Hydrocortisone EP Impurity J | 16463-74-4 | C23H32O6 | ||||||||
| Hydrocortisone EP Impurity K | 640-87-9 | C23H32O5 | ||||||||
| Hydrocortisone EP Impurity L | 641-77-0 | C21H30O4 | ||||||||
| Hydrocortisone EP Impurity M,11-Epihydrocortisone | 566-35-8 | C21H30O5 | ||||||||
| Hydrocortisone EP Impurity N(Symmetricaldimer) | N/A | C42H58O10 | ||||||||
| Hydrocortisone EP Impurity O | 154032-37-8 | C21H30O6 | ||||||||
| Iohexol | 66108-95-0 | C19H26I3N3O9 | ||||||||
| Iohexol EP Impurity A(Iohexol USP Related Compound A, Iodixanol EP Impurity B) | 31127-80-7 | C16H20I3N3O7 | ||||||||
| Iohexol EP Impurity B | N/A | C22H32I3N3O11 | ||||||||
| Iohexol EP Impurity C | N/A | C22H32I3N3O11 | ||||||||
| Iohexol EP Impurity D (Mixture of Diastereomers) | 157739-09-8 | C22H32I3N3O11 | ||||||||
| Iohexol EP Impurity E | N/A | C22H32I3N3O11 | ||||||||
| Iohexol EP Impurity F | N/A | C14H19I2N3O6 | ||||||||
| Iohexol EP Impurity G | N/A | C16H21I2N3O7 | ||||||||
| Iohexol EP Impurity H | 1651211-79-8 | C19H27I2N3O9 | ||||||||
| Iohexol EP Impurity I | 196309-19-0 | C17H23I2N3O8 | ||||||||
| Iohexol EP Impurity J | 76801-93-9 | C14H18I3N3O6 | ||||||||
| Iohexol EP Impurity K | 35453-19-1 | C8H4I3NO4 | ||||||||
| Iohexol EP Impurity L | 37441-29-5 | C8H2Cl2I3NO2 | ||||||||
| Iohexol EP Impurity M | N/A | C17H25I2N3O8 | ||||||||
| Iohexol EP Impurity N | N/A | C21H28I3N3O10 | ||||||||
| Iohexol EP Impurity O | N/A | C21H28I3N3O10 | ||||||||
| Iohexol EP Impurity P | N/A | C21H28I3N3O10 | ||||||||
| Iohexol EP Impurity Q | N/A | C21H28I3N3O10 | ||||||||
| Itraconazole | 84625-61-6 | C35H38Cl2N8O4 | ||||||||
| Itraconazole EP Impurity A | 252964-68-4 | Molecular Weight: | ||||||||
| Itraconazole EP Impurity B | 854372-77-3 | C35H38Cl2N8O4 | ||||||||
| Itraconazole EP Impurity C | 74855-91-7 | C34H36Cl2N8O4 | ||||||||
| Itraconazole EP Impurity D | 89848-49-7 | C34H36Cl2N8O4 | ||||||||
| Itraconazole EP Impurity E | 252964-65-1 | C35H38Cl2N8O4 | ||||||||
| Imipenem | ||||||||||
| Imipenem EP Impurity A | 59995-64-1 | C11H16N2O4S | ||||||||
| Piperacillin | 161477-96-1 | C23H27N5O7S | ||||||||
| Piperacillin EP Impurity A | 69-53-4 | C16H19N3O4S | ||||||||
| Piperacillin EP Impurity B (Mixture of Diastereomers)，Piperacillin penicilloic acid | 64817-22-7 | C23H29N5O8S | ||||||||
| Piperacillin EP Impurity C (Mixture of Diastereomers) | 64817-23-8 | C22H29N5O6S | ||||||||
| Piperacillin EP Impurity D | 65772-67-0 | C39H44N8O10S2 | ||||||||
| Piperacillin EP Impurity E | 59702-31-7 | C6H10N2O2 | ||||||||
| Piperacillin EP Impurity F (Mixture of Diastereomers) | N/A | C25H31N5O9S | ||||||||
| Piperacillin EP Impurity G | 63422-71-9 | C15H17N3O5 | ||||||||
| Piperacillin EP Impurity H | 551-16-6 | C8H12N2O3S | ||||||||
| Piperacillin EP Impurity I | 158411-82-6 | C6H11NO3S | ||||||||
| Tranexamic Acid | 1197-18-8 | C8H15NO2 | ||||||||
| Tranexamic Acid EP Impurity A | 93940-19-3 | C16H27NO4 | ||||||||
| Tranexamic Acid EP Impurity B | 1197-17-7 | C8H15NO2 | ||||||||
| Tranexamic Acid EP Impurity C | 330838-52-3,1803601-44-6(chloride) | C8H13NO2 | ||||||||
| Tranexamic Acid EP Impurity D | 56-91-7 | C8H9NO2 | ||||||||
| Vortioxetine | 508233-74-7 | C18H22N2S | ||||||||
| Vortioxetine Impurity C | 1293489-74-3 | C18H22N2S | ||||||||
| Vortioxetine Impurity D | 508233-75-8 | C18H22N2S | ||||||||
| Vortioxetine Impurity E | 508233-77-0 | C18H22N2S | ||||||||
| Vortioxetine Impurity F | 508233-76-9 | C18H22N3S | ||||||||